Kobalt (II) arilkarboksilatlarının nikotinamid ile komplekslerini sentezi ve yapılarının incelenmesi
dc.contributor.advisor | Necefoğlu, Hacali | |
dc.contributor.author | Karapehlivan, Kivilcim | |
dc.date.accessioned | 2020-12-06T10:12:30Z | |
dc.date.available | 2020-12-06T10:12:30Z | |
dc.date.submitted | 1998 | |
dc.date.issued | 2018-08-06 | |
dc.identifier.uri | https://acikbilim.yok.gov.tr/handle/20.500.12812/97262 | |
dc.description.abstract | ÖZET İlk defa olarak farklı sentez yöntemiyle kobalt (II) arilkarboksilatlann nikotinamid ile yedi yeni kompleksi elde edilmiştir: Co(C6HsCOO)2(NA)2 (I), Co(C6H5COO)2(NA)2(H20)2 (II), Co(4-HOC6H4COO)2(NA)2 (III), Co(4- HOC6H4COO)2(NA)28H20 (IV), Co(2-HOC(^COO)2(NA)2(H20)2 (V), Co(4- H2NC6H4COO)2(NA)24H20 (VI), Co(4-02NC6H4COO)2(NA)2(H20)2 (VH) sentezlenen kompleksler İR spektroskopik, DTA ve X-ray toz analizi yöntemleriyle incelenmişlerdir. Co(4-02NC6H4COO)2(NA)2(H20)2 (VII) kompleksinin kristal yapısı X-ray tek kristal analizi yöntemiyle çözülerek, bu kompleksin simetri merkezli monomerik yapıya sahip olduğu saptanmıştır. Tüm Iigandlar monodentanttırlar. Su ve benzoat gruplarının dört oksijen atomu kobalt çevresinde kare-düzlem üzerinde yerleşiyorlar (Co-Oroo 2,091(2) Â, Co-Oh20 2,136(1) Â). Koordinasyon çevresi iki nikotinamid molükülünün piridin azot atomlanyla oktahedrona tamamlanıyor (Co-Np,. 2, 134(2) Â). IV | |
dc.description.abstract | ABSTRACT Seven new cobalt (II) arylcarboxylate complexes have been obtained by different synthesys method for the first time: Co(C6H5COO)2(NA)2 (I), Co(C6H5COO)2(NA)2(H20)2 (II), Co(4-HOC6H4COO)2(NA)2 (HI), Co(4- HOC6H4COO)2(NA)28H20 (IV), Co(2-HOC6H4COO)2(NA)2(H20)2 (V), Co(4- H2NC6H4COO)2(NA)24H20 (VI), Co(4-02NC6H4COO)2(NA)2(H20)2 (VH). These complexes have been studied by ER. spectroscopy, DTA and X-ray powder analysis method. Crystal structure of Co(02NC6H4COO)2(NA)2(H20)2 (VH) complex have been solved by X-ray analysis. The complex is a monomelic one with Co in a centre of symetry. All ligands are monodentate and the O atoms of each water molecule and benzoate group form a slightly distorted square-planar coordination around the Co atom (Co-Oroo 2,091(2) A, Co-Omo 2,136(1) Â), which completed to an octahedron by the pyridine N atoms of nicotinamide (Co-Npy 2,134(2)). | en_US |
dc.language | Turkish | |
dc.language.iso | tr | |
dc.rights | info:eu-repo/semantics/openAccess | |
dc.rights | Attribution 4.0 United States | tr_TR |
dc.rights.uri | https://creativecommons.org/licenses/by/4.0/ | |
dc.subject | Kimya | tr_TR |
dc.subject | Chemistry | en_US |
dc.title | Kobalt (II) arilkarboksilatlarının nikotinamid ile komplekslerini sentezi ve yapılarının incelenmesi | |
dc.title.alternative | The Synthesis of complexes of cobalt (II) arylcarboxylates complexes with nicotinamide and the analysis of thesir structures | |
dc.type | masterThesis | |
dc.date.updated | 2018-08-06 | |
dc.contributor.department | Diğer | |
dc.subject.ytm | Synthesis | |
dc.subject.ytm | Cobalt | |
dc.subject.ytm | Nicotinamide | |
dc.subject.ytm | Complexes | |
dc.identifier.yokid | 93688 | |
dc.publisher.institute | Fen Bilimleri Enstitüsü | |
dc.publisher.university | KAFKAS ÜNİVERSİTESİ | |
dc.identifier.thesisid | 93688 | |
dc.description.pages | 61 | |
dc.publisher.discipline | Diğer |